C35H52N2O5S2 — CID 118026400
(2,5-dioxopyrrolidin-1-yl) 2-[2-[3-(benzenecarbonothioylsulfanyl)-2-(dimethylcarbamoyl)-3-methylbutyl]-1,2-dimethylcyclobutyl]-4,4,5,5-tetramethylhexanoate (PubChem CID 118026400) has the molecular formula C35H52N2O5S2 and a molecular weight of 644.94 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[2-[3-(benzenecarbonothioylsulfanyl)-2-(dimethylcarbamoyl)-3-methylbutyl]-1,2-dimethylcyclobutyl]-4,4,5,5-tetramethylhexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-[3-(benzenecarbonothioylsulfanyl)-2-(dimethylcarbamoyl)-3-methylbutyl]-1,2-dimethylcyclobutyl]-4,4,5,5-tetramethylhexanoate |
|---|---|
| PubChem CID | 118026400 |
| Molecular Formula | C35H52N2O5S2 |
| Molecular Weight | 644.94 g/mol |
| Exact Mass | 644.33 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-[3-(benzenecarbonothioylsulfanyl)-2-(dimethylcarbamoyl)-3-methylbutyl]-1,2-dimethylcyclobutyl]-4,4,5,5-tetramethylhexanoate |
| SMILES | CN(C)C(=O)C(CC1(C)CCC1(C)C(CC(C)(C)C(C)(C)C)C(=O)ON1C(=O)CCC1=O)C(C)(C)SC(=S)c1ccccc1 |
| InChI | InChI=1S/C35H52N2O5S2/c1-31(2,3)32(4,5)21-25(29(41)42-37-26(38)17-18-27(37)39)35(9)20-19-34(35,8)22-24(28(40)36(10)11)33(6,7)44-30(43)23-15-13-12-14-16-23/h12-16,24-25H,17-22H2,1-11H3 |
| InChIKey | WKWXGADRVCURGQ-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.94 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|