C24H23Cl2F3N2O4S — CID 118035816
[3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophen-1-yl] N-(oxan-3-yl)carbamate (PubChem CID 118035816) has the molecular formula C24H23Cl2F3N2O4S and a molecular weight of 563.43 g/mol. Its IUPAC name is [3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophen-1-yl] N-(oxan-3-yl)carbamate.
| Compound Name | [3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophen-1-yl] N-(oxan-3-yl)carbamate |
|---|---|
| PubChem CID | 118035816 |
| Molecular Formula | C24H23Cl2F3N2O4S |
| Molecular Weight | 563.43 g/mol |
| Exact Mass | 562.07 |
| IUPAC Name | [3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophen-1-yl] N-(oxan-3-yl)carbamate |
| SMILES | O=C(NC1CCCOC1)Oc1sc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)c2c1CCCC2 |
| InChI | InChI=1S/C24H23Cl2F3N2O4S/c25-14-8-13(9-15(26)10-14)23(24(27,28)29)11-19(31-35-23)20-17-5-1-2-6-18(17)21(36-20)34-22(32)30-16-4-3-7-33-12-16/h8-10,16H,1-7,11-12H2,(H,30,32) |
| InChIKey | LSFGKKPQFVGXGM-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.43 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |