C26H20Cl2F3N3O4S — CID 118035677
[3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophen-1-yl] N-(4-carbamoylphenyl)carbamate (PubChem CID 118035677) has the molecular formula C26H20Cl2F3N3O4S and a molecular weight of 598.43 g/mol. Its IUPAC name is [3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophen-1-yl] N-(4-carbamoylphenyl)carbamate.
| Compound Name | [3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophen-1-yl] N-(4-carbamoylphenyl)carbamate |
|---|---|
| PubChem CID | 118035677 |
| Molecular Formula | C26H20Cl2F3N3O4S |
| Molecular Weight | 598.43 g/mol |
| Exact Mass | 597.05 |
| IUPAC Name | [3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophen-1-yl] N-(4-carbamoylphenyl)carbamate |
| SMILES | NC(=O)c1ccc(NC(=O)Oc2sc(C3=NOC(c4cc(Cl)cc(Cl)c4)(C(F)(F)F)C3)c3c2CCCC3)cc1 |
| InChI | InChI=1S/C26H20Cl2F3N3O4S/c27-15-9-14(10-16(28)11-15)25(26(29,30)31)12-20(34-38-25)21-18-3-1-2-4-19(18)23(39-21)37-24(36)33-17-7-5-13(6-8-17)22(32)35/h5-11H,1-4,12H2,(H2,32,35)(H,33,36) |
| InChIKey | KWVJZXFMTVSGOS-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.43 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |