C22H16Cl2F7N3O4S — CID 118035753
[1-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-5,6-dihydro-4H-cyclopenta[c]thiophen-3-yl] N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]carbamate (PubChem CID 118035753) has the molecular formula C22H16Cl2F7N3O4S and a molecular weight of 622.35 g/mol. Its IUPAC name is [1-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-5,6-dihydro-4H-cyclopenta[c]thiophen-3-yl] N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]carbamate.
| Compound Name | [1-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-5,6-dihydro-4H-cyclopenta[c]thiophen-3-yl] N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 118035753 |
| Molecular Formula | C22H16Cl2F7N3O4S |
| Molecular Weight | 622.35 g/mol |
| Exact Mass | 621.01 |
| IUPAC Name | [1-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-5,6-dihydro-4H-cyclopenta[c]thiophen-3-yl] N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]carbamate |
| SMILES | O=C(CNC(=O)Oc1sc(C2=NOC(c3cc(Cl)c(F)c(Cl)c3)(C(F)(F)F)C2)c2c1CCC2)NCC(F)(F)F |
| InChI | InChI=1S/C22H16Cl2F7N3O4S/c23-12-4-9(5-13(24)16(12)25)20(22(29,30)31)6-14(34-38-20)17-10-2-1-3-11(10)18(39-17)37-19(36)32-7-15(35)33-8-21(26,27)28/h4-5H,1-3,6-8H2,(H,32,36)(H,33,35) |
| InChIKey | IRNSDTFNVGPBGG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.35 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|