C24H23Cl2F3N2O5S2 — CID 118035885
[3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophen-1-yl] N-(1,1-dioxothian-4-yl)carbamate (PubChem CID 118035885) has the molecular formula C24H23Cl2F3N2O5S2 and a molecular weight of 611.49 g/mol. Its IUPAC name is [3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophen-1-yl] N-(1,1-dioxothian-4-yl)carbamate.
| Compound Name | [3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophen-1-yl] N-(1,1-dioxothian-4-yl)carbamate |
|---|---|
| PubChem CID | 118035885 |
| Molecular Formula | C24H23Cl2F3N2O5S2 |
| Molecular Weight | 611.49 g/mol |
| Exact Mass | 610.04 |
| IUPAC Name | [3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophen-1-yl] N-(1,1-dioxothian-4-yl)carbamate |
| SMILES | O=C(NC1CCS(=O)(=O)CC1)Oc1sc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)c2c1CCCC2 |
| InChI | InChI=1S/C24H23Cl2F3N2O5S2/c25-14-9-13(10-15(26)11-14)23(24(27,28)29)12-19(31-36-23)20-17-3-1-2-4-18(17)21(37-20)35-22(32)30-16-5-7-38(33,34)8-6-16/h9-11,16H,1-8,12H2,(H,30,32) |
| InChIKey | ZWXQMZYNGDTTCL-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.49 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |