C18H25N3O2 — CID 118037468
tert-butyl 2-(1-aminoindol-2-yl)piperidine-1-carboxylate (PubChem CID 118037468) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is tert-butyl 2-(1-aminoindol-2-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-(1-aminoindol-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118037468 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | tert-butyl 2-(1-aminoindol-2-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1c1cc2ccccc2n1N |
| InChI | InChI=1S/C18H25N3O2/c1-18(2,3)23-17(22)20-11-7-6-10-15(20)16-12-13-8-4-5-9-14(13)21(16)19/h4-5,8-9,12,15H,6-7,10-11,19H2,1-3H3 |
| InChIKey | NOQMVXBBCFLYSR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |