C21H19N5O2 — CID 118037489
7-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-(6-methylimidazo[1,2-a]pyrazin-2-yl)chromen-2-one (PubChem CID 118037489) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is 7-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-(6-methylimidazo[1,2-a]pyrazin-2-yl)chromen-2-one.
| Compound Name | 7-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-(6-methylimidazo[1,2-a]pyrazin-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 118037489 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 7-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-(6-methylimidazo[1,2-a]pyrazin-2-yl)chromen-2-one |
| SMILES | Cc1cn2cc(-c3cc4ccc(N5C[C@@H]6C[C@H]5CN6)cc4oc3=O)nc2cn1 |
| InChI | InChI=1S/C21H19N5O2/c1-12-9-25-11-18(24-20(25)8-22-12)17-4-13-2-3-15(6-19(13)28-21(17)27)26-10-14-5-16(26)7-23-14/h2-4,6,8-9,11,14,16,23H,5,7,10H2,1H3/t14-,16-/m0/s1 |
| InChIKey | IJZJGKWRSNADHR-HOCLYGCPSA-N |
| XLogP | 2.36 |
| TPSA | 75.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|