C18H30N3O9P — CID 118065660
[(2R,3R,5R)-3-aminooxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl [(3S,5S)-2,5-dimethyloxolan-3-yl]methyl methyl phosphate (PubChem CID 118065660) has the molecular formula C18H30N3O9P and a molecular weight of 463.42 g/mol. Its IUPAC name is [(2R,3R,5R)-3-aminooxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl [(3S,5S)-2,5-dimethyloxolan-3-yl]methyl methyl phosphate.
| Compound Name | [(2R,3R,5R)-3-aminooxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl [(3S,5S)-2,5-dimethyloxolan-3-yl]methyl methyl phosphate |
|---|---|
| PubChem CID | 118065660 |
| Molecular Formula | C18H30N3O9P |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | [(2R,3R,5R)-3-aminooxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl [(3S,5S)-2,5-dimethyloxolan-3-yl]methyl methyl phosphate |
| SMILES | COP(=O)(OC[C@@H]1C[C@H](C)OC1C)OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@H]1ON |
| InChI | InChI=1S/C18H30N3O9P/c1-10-7-21(18(23)20-17(10)22)16-6-14(30-19)15(29-16)9-27-31(24,25-4)26-8-13-5-11(2)28-12(13)3/h7,11-16H,5-6,8-9,19H2,1-4H3,(H,20,22,23)/t11-,12?,13-,14+,15+,16+,31?/m0/s1 |
| InChIKey | KCVJWWCAJNCGDC-YLUCGFHPSA-N |
| XLogP | 0.99 |
| TPSA | 153.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|