C14H20O3 — CID 11806631
(3aS,5Z,9aR)-3a-methylspiro[1,2,4,7,8,9a-hexahydrocyclopenta[8]annulene-3,2'-1,3-dioxolane]-9-one (PubChem CID 11806631) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (3aS,5Z,9aR)-3a-methylspiro[1,2,4,7,8,9a-hexahydrocyclopenta[8]annulene-3,2'-1,3-dioxolane]-9-one.
| Compound Name | (3aS,5Z,9aR)-3a-methylspiro[1,2,4,7,8,9a-hexahydrocyclopenta[8]annulene-3,2'-1,3-dioxolane]-9-one |
|---|---|
| PubChem CID | 11806631 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (3aS,5Z,9aR)-3a-methylspiro[1,2,4,7,8,9a-hexahydrocyclopenta[8]annulene-3,2'-1,3-dioxolane]-9-one |
| SMILES | C[C@]12C/C=C\CCC(=O)[C@@H]1CCC21OCCO1 |
| InChI | InChI=1S/C14H20O3/c1-13-7-4-2-3-5-12(15)11(13)6-8-14(13)16-9-10-17-14/h2,4,11H,3,5-10H2,1H3/b4-2-/t11-,13-/m0/s1 |
| InChIKey | XYOJVEOOHUKMLW-SQKDYNKASA-N |
| XLogP | 2.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|