C11H7N3O3 — CID 118067980
(2,5-diisocyanato-3,6-dimethylphenyl) cyanate (PubChem CID 118067980) has the molecular formula C11H7N3O3 and a molecular weight of 229.19 g/mol. Its IUPAC name is (2,5-diisocyanato-3,6-dimethylphenyl) cyanate.
| Compound Name | (2,5-diisocyanato-3,6-dimethylphenyl) cyanate |
|---|---|
| PubChem CID | 118067980 |
| Molecular Formula | C11H7N3O3 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | (2,5-diisocyanato-3,6-dimethylphenyl) cyanate |
| SMILES | Cc1cc(N=C=O)c(C)c(OC#N)c1N=C=O |
| InChI | InChI=1S/C11H7N3O3/c1-7-3-9(13-5-15)8(2)11(17-4-12)10(7)14-6-16/h3H,1-2H3 |
| InChIKey | KGVOTJRTAQZNOD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 91.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|