C14H22N6O6 — CID 118071895
(4S)-4-amino-5-[1-[(2S)-2,5-diamino-5-oxopentanoyl]-3,6-dioxopiperazin-2-yl]-5-oxopentanamide (PubChem CID 118071895) has the molecular formula C14H22N6O6 and a molecular weight of 370.37 g/mol. Its IUPAC name is (4S)-4-amino-5-[1-[(2S)-2,5-diamino-5-oxopentanoyl]-3,6-dioxopiperazin-2-yl]-5-oxopentanamide.
| Compound Name | (4S)-4-amino-5-[1-[(2S)-2,5-diamino-5-oxopentanoyl]-3,6-dioxopiperazin-2-yl]-5-oxopentanamide |
|---|---|
| PubChem CID | 118071895 |
| Molecular Formula | C14H22N6O6 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | (4S)-4-amino-5-[1-[(2S)-2,5-diamino-5-oxopentanoyl]-3,6-dioxopiperazin-2-yl]-5-oxopentanamide |
| SMILES | NC(=O)CC[C@H](N)C(=O)C1C(=O)NCC(=O)N1C(=O)[C@@H](N)CCC(N)=O |
| InChI | InChI=1S/C14H22N6O6/c15-6(1-3-8(17)21)12(24)11-13(25)19-5-10(23)20(11)14(26)7(16)2-4-9(18)22/h6-7,11H,1-5,15-16H2,(H2,17,21)(H2,18,22)(H,19,25)/t6-,7-,11?/m0/s1 |
| InChIKey | PQJKOEUPIUTKDH-YKFGJVJNSA-N |
| XLogP | -4.41 |
| TPSA | 221.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | -4.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|