C26H27FN2O — CID 118091167
(2S)-2-[4-[(E)-2-cyanoethenyl]phenyl]-2-cyclopentyl-N-[5-(cyclopropylmethyl)-2-fluorophenyl]acetamide (PubChem CID 118091167) has the molecular formula C26H27FN2O and a molecular weight of 402.51 g/mol. Its IUPAC name is (2S)-2-[4-[(E)-2-cyanoethenyl]phenyl]-2-cyclopentyl-N-[5-(cyclopropylmethyl)-2-fluorophenyl]acetamide.
| Compound Name | (2S)-2-[4-[(E)-2-cyanoethenyl]phenyl]-2-cyclopentyl-N-[5-(cyclopropylmethyl)-2-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 118091167 |
| Molecular Formula | C26H27FN2O |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (2S)-2-[4-[(E)-2-cyanoethenyl]phenyl]-2-cyclopentyl-N-[5-(cyclopropylmethyl)-2-fluorophenyl]acetamide |
| SMILES | N#C/C=C/c1ccc([C@@H](C(=O)Nc2cc(CC3CC3)ccc2F)C2CCCC2)cc1 |
| InChI | InChI=1S/C26H27FN2O/c27-23-14-11-20(16-19-7-8-19)17-24(23)29-26(30)25(21-5-1-2-6-21)22-12-9-18(10-13-22)4-3-15-28/h3-4,9-14,17,19,21,25H,1-2,5-8,16H2,(H,29,30)/b4-3+/t25-/m0/s1 |
| InChIKey | HPBWXJVVSCKBOF-MQRYDUTKSA-N |
| XLogP | 6.23 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|