C12H17F2NO4S — CID 118095396
2-(dimethoxymethyl)-1,3-difluoro-4-[3-(sulfinoamino)propyl]benzene (PubChem CID 118095396) has the molecular formula C12H17F2NO4S and a molecular weight of 309.33 g/mol. Its IUPAC name is 2-(dimethoxymethyl)-1,3-difluoro-4-[3-(sulfinoamino)propyl]benzene.
| Compound Name | 2-(dimethoxymethyl)-1,3-difluoro-4-[3-(sulfinoamino)propyl]benzene |
|---|---|
| PubChem CID | 118095396 |
| Molecular Formula | C12H17F2NO4S |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2-(dimethoxymethyl)-1,3-difluoro-4-[3-(sulfinoamino)propyl]benzene |
| SMILES | COC(OC)c1c(F)ccc(CCCNS(=O)O)c1F |
| InChI | InChI=1S/C12H17F2NO4S/c1-18-12(19-2)10-9(13)6-5-8(11(10)14)4-3-7-15-20(16)17/h5-6,12,15H,3-4,7H2,1-2H3,(H,16,17) |
| InChIKey | YSNGYBCLWVCROT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|