C28H37NO2Si — CID 11812367
benzyl (2S,5R,6S)-2-[[dimethyl(phenyl)silyl]methyl]-6-ethenyl-1-azaspiro[4.5]decane-1-carboxylate (PubChem CID 11812367) has the molecular formula C28H37NO2Si and a molecular weight of 447.70 g/mol. Its IUPAC name is benzyl (2S,5R,6S)-2-[[dimethyl(phenyl)silyl]methyl]-6-ethenyl-1-azaspiro[4.5]decane-1-carboxylate.
| Compound Name | benzyl (2S,5R,6S)-2-[[dimethyl(phenyl)silyl]methyl]-6-ethenyl-1-azaspiro[4.5]decane-1-carboxylate |
|---|---|
| PubChem CID | 11812367 |
| Molecular Formula | C28H37NO2Si |
| Molecular Weight | 447.70 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | benzyl (2S,5R,6S)-2-[[dimethyl(phenyl)silyl]methyl]-6-ethenyl-1-azaspiro[4.5]decane-1-carboxylate |
| SMILES | C=C[C@@H]1CCCC[C@@]12CC[C@@H](C[Si](C)(C)c1ccccc1)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H37NO2Si/c1-4-24-15-11-12-19-28(24)20-18-25(22-32(2,3)26-16-9-6-10-17-26)29(28)27(30)31-21-23-13-7-5-8-14-23/h4-10,13-14,16-17,24-25H,1,11-12,15,18-22H2,2-3H3/t24-,25+,28-/m1/s1 |
| InChIKey | GYXXALIRYBPUBF-CERRFVOPSA-N |
| XLogP | 6.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.70 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|