C38H40N2O8 — CID 11814334
6,18-dimethyl-12-methylidene-10,14,27,30,33,36-hexaoxa-3,21-diazapentacyclo[35.2.2.223,26.04,9.015,20]tritetraconta-1(40),4(9),5,7,15(20),16,18,23,25,37(41),38,42-dodecaene-2,22-dione (PubChem CID 11814334) has the molecular formula C38H40N2O8 and a molecular weight of 652.74 g/mol. Its IUPAC name is 6,18-dimethyl-12-methylidene-10,14,27,30,33,36-hexaoxa-3,21-diazapentacyclo[35.2.2.223,26.04,9.015,20]tritetraconta-1(40),4(9),5,7,15(20),16,18,23,25,37(41),38,42-dodecaene-2,22-dione.
| Compound Name | 6,18-dimethyl-12-methylidene-10,14,27,30,33,36-hexaoxa-3,21-diazapentacyclo[35.2.2.223,26.04,9.015,20]tritetraconta-1(40),4(9),5,7,15(20),16,18,23,25,37(41),38,42-dodecaene-2,22-dione |
|---|---|
| PubChem CID | 11814334 |
| Molecular Formula | C38H40N2O8 |
| Molecular Weight | 652.74 g/mol |
| Exact Mass | 652.28 |
| IUPAC Name | 6,18-dimethyl-12-methylidene-10,14,27,30,33,36-hexaoxa-3,21-diazapentacyclo[35.2.2.223,26.04,9.015,20]tritetraconta-1(40),4(9),5,7,15(20),16,18,23,25,37(41),38,42-dodecaene-2,22-dione |
| SMILES | C=C1COc2ccc(C)cc2NC(=O)c2ccc(cc2)OCCOCCOCCOc2ccc(cc2)C(=O)Nc2cc(C)ccc2OC1 |
| InChI | InChI=1S/C38H40N2O8/c1-26-4-14-35-33(22-26)39-37(41)29-6-10-31(11-7-29)45-20-18-43-16-17-44-19-21-46-32-12-8-30(9-13-32)38(42)40-34-23-27(2)5-15-36(34)48-25-28(3)24-47-35/h4-15,22-23H,3,16-21,24-25H2,1-2H3,(H,39,41)(H,40,42) |
| InChIKey | LMFRQNXVCHZMDE-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.74 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|