C43H26N6 — CID 118152689
6-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-quinolin-8-ylcarbazole-3-carbonitrile (PubChem CID 118152689) has the molecular formula C43H26N6 and a molecular weight of 626.72 g/mol. Its IUPAC name is 6-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-quinolin-8-ylcarbazole-3-carbonitrile.
| Compound Name | 6-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-quinolin-8-ylcarbazole-3-carbonitrile |
|---|---|
| PubChem CID | 118152689 |
| Molecular Formula | C43H26N6 |
| Molecular Weight | 626.72 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | 6-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-quinolin-8-ylcarbazole-3-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)c1cc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)ccc1n2-c1cccc2cccnc12 |
| InChI | InChI=1S/C43H26N6/c44-27-28-16-22-37-35(25-28)36-26-34(21-23-38(36)49(37)39-15-7-13-30-14-8-24-45-40(30)39)29-17-19-33(20-18-29)43-47-41(31-9-3-1-4-10-31)46-42(48-43)32-11-5-2-6-12-32/h1-26H |
| InChIKey | NJEIOGARVUYJNK-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.72 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |