C11H19NO2 — CID 11816443
2-acetyl-N,3,3,4-tetramethylpent-4-enamide (PubChem CID 11816443) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-acetyl-N,3,3,4-tetramethylpent-4-enamide.
| Compound Name | 2-acetyl-N,3,3,4-tetramethylpent-4-enamide |
|---|---|
| PubChem CID | 11816443 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 2-acetyl-N,3,3,4-tetramethylpent-4-enamide |
| SMILES | C=C(C)C(C)(C)C(C(C)=O)C(=O)NC |
| InChI | InChI=1S/C11H19NO2/c1-7(2)11(4,5)9(8(3)13)10(14)12-6/h9H,1H2,2-6H3,(H,12,14) |
| InChIKey | MUUBOGTZPJNPAF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|