About 2-(N-hydroxy-C-methylsulfonylcarbonimidoyl)-N,3,3-trimethylbutanamide
2-(N-hydroxy-C-methylsulfonylcarbonimidoyl)-N,3,3-trimethylbutanamide (PubChem CID 152749693) has the molecular formula C9H18N2O4S
and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-(N-hydroxy-C-methylsulfonylcarbonimidoyl)-N,3,3-trimethylbutanamide.
Molecular Properties
| Compound Name | 2-(N-hydroxy-C-methylsulfonylcarbonimidoyl)-N,3,3-trimethylbutanamide |
| PubChem CID | 152749693 |
| Molecular Formula | C9H18N2O4S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-(N-hydroxy-C-methylsulfonylcarbonimidoyl)-N,3,3-trimethylbutanamide |
| SMILES | CNC(=O)C(C(=NO)S(C)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C9H18N2O4S/c1-9(2,3)6(7(12)10-4)8(11-13)16(5,14)15/h6,13H,1-5H3,(H,10,12) |
| InChIKey | CFKSOJCUYPOBQJ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(N-hydroxy-C-methylsulfonylcarbonimidoyl)-N,3,3-trimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N-hydroxy-C-methylsulfonylcarbonimidoyl)-N,3,3-trimethylbutanamide?
The IUPAC name of 2-(N-hydroxy-C-methylsulfonylcarbonimidoyl)-N,3,3-trimethylbutanamide (CID 152749693) is 2-(N-hydroxy-C-methylsulfonylcarbonimidoyl)-N,3,3-trimethylbutanamide.
What is the SMILES notation for 2-(N-hydroxy-C-methylsulfonylcarbonimidoyl)-N,3,3-trimethylbutanamide?
The canonical SMILES for 2-(N-hydroxy-C-methylsulfonylcarbonimidoyl)-N,3,3-trimethylbutanamide is CNC(=O)C(C(=NO)S(C)(=O)=O)C(C)(C)C.
What is the InChIKey of 2-(N-hydroxy-C-methylsulfonylcarbonimidoyl)-N,3,3-trimethylbutanamide?
The InChIKey is CFKSOJCUYPOBQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O4S/c1-9(2,3)6(7(12)10-4)8(11-13)16(5,14)15/h6,13H,1-5H3,(H,10,12).
What are the key properties of 2-(N-hydroxy-C-methylsulfonylcarbonimidoyl)-N,3,3-trimethylbutanamide?
2-(N-hydroxy-C-methylsulfonylcarbonimidoyl)-N,3,3-trimethylbutanamide has a molecular weight of 250.32 g/mol, XLogP of 0.23, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N-hydroxy-C-methylsulfonylcarbonimidoyl)-N,3,3-trimethylbutanamide is sourced from PubChem (CID 152749693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).