C8H13F3N2O2 — CID 22769396
(1Z)-3-(difluoromethyl)-N-hydroxy-2,2-dimethyl-4-(methylamino)-4-oxobutanimidoyl fluoride (PubChem CID 22769396) has the molecular formula C8H13F3N2O2 and a molecular weight of 226.20 g/mol. Its IUPAC name is (1Z)-3-(difluoromethyl)-N-hydroxy-2,2-dimethyl-4-(methylamino)-4-oxobutanimidoyl fluoride.
| Compound Name | (1Z)-3-(difluoromethyl)-N-hydroxy-2,2-dimethyl-4-(methylamino)-4-oxobutanimidoyl fluoride |
|---|---|
| PubChem CID | 22769396 |
| Molecular Formula | C8H13F3N2O2 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | (1Z)-3-(difluoromethyl)-N-hydroxy-2,2-dimethyl-4-(methylamino)-4-oxobutanimidoyl fluoride |
| SMILES | CNC(=O)C(C(F)F)C(C)(C)/C(F)=N/O |
| InChI | InChI=1S/C8H13F3N2O2/c1-8(2,7(11)13-15)4(5(9)10)6(14)12-3/h4-5,15H,1-3H3,(H,12,14)/b13-7- |
| InChIKey | SDGKPBXVMLDZRU-QPEQYQDCSA-N |
| XLogP | 1.40 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|