C7H13NO3 — CID 58181403
(3R,4S)-3,4-dihydroxy-5-(methylamino)hex-5-en-2-one (PubChem CID 58181403) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is (3R,4S)-3,4-dihydroxy-5-(methylamino)hex-5-en-2-one.
| Compound Name | (3R,4S)-3,4-dihydroxy-5-(methylamino)hex-5-en-2-one |
|---|---|
| PubChem CID | 58181403 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | (3R,4S)-3,4-dihydroxy-5-(methylamino)hex-5-en-2-one |
| SMILES | C=C(NC)[C@H](O)[C@@H](O)C(C)=O |
| InChI | InChI=1S/C7H13NO3/c1-4(8-3)6(10)7(11)5(2)9/h6-8,10-11H,1H2,2-3H3/t6-,7-/m0/s1 |
| InChIKey | YXTKTJLPYDXEFG-BQBZGAKWSA-N |
| XLogP | -0.97 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |