C14H16Cl3N7O — CID 118165429
1-[1-(5-amino-1H-1,2,4-triazol-3-yl)piperidin-4-yl]-3-(2,4,5-trichlorophenyl)urea (PubChem CID 118165429) has the molecular formula C14H16Cl3N7O and a molecular weight of 404.69 g/mol. Its IUPAC name is 1-[1-(5-amino-1H-1,2,4-triazol-3-yl)piperidin-4-yl]-3-(2,4,5-trichlorophenyl)urea.
| Compound Name | 1-[1-(5-amino-1H-1,2,4-triazol-3-yl)piperidin-4-yl]-3-(2,4,5-trichlorophenyl)urea |
|---|---|
| PubChem CID | 118165429 |
| Molecular Formula | C14H16Cl3N7O |
| Molecular Weight | 404.69 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 1-[1-(5-amino-1H-1,2,4-triazol-3-yl)piperidin-4-yl]-3-(2,4,5-trichlorophenyl)urea |
| SMILES | Nc1nc(N2CCC(NC(=O)Nc3cc(Cl)c(Cl)cc3Cl)CC2)n[nH]1 |
| InChI | InChI=1S/C14H16Cl3N7O/c15-8-5-10(17)11(6-9(8)16)20-14(25)19-7-1-3-24(4-2-7)13-21-12(18)22-23-13/h5-7H,1-4H2,(H2,19,20,25)(H3,18,21,22,23) |
| InChIKey | CTDZYTOTNRGPGZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.69 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|