C14H19BeN7O — CID 163467523
beryllium;1-[1-(5-amino-1H-1,2,4-triazol-3-yl)piperidin-4-yl]-3-phenylurea;hydride (PubChem CID 163467523) has the molecular formula C14H19BeN7O and a molecular weight of 310.37 g/mol. Its IUPAC name is beryllium;1-[1-(5-amino-1H-1,2,4-triazol-3-yl)piperidin-4-yl]-3-phenylurea;hydride.
| Compound Name | beryllium;1-[1-(5-amino-1H-1,2,4-triazol-3-yl)piperidin-4-yl]-3-phenylurea;hydride |
|---|---|
| PubChem CID | 163467523 |
| Molecular Formula | C14H19BeN7O |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | beryllium;1-[1-(5-amino-1H-1,2,4-triazol-3-yl)piperidin-4-yl]-3-phenylurea;hydride |
| SMILES | Nc1nc(N2CCC(NC(=O)Nc3cc[c-]cc3)CC2)n[nH]1.[Be+2].[H-] |
| InChI | InChI=1S/C14H18N7O.Be.H/c15-12-18-13(20-19-12)21-8-6-11(7-9-21)17-14(22)16-10-4-2-1-3-5-10;;/h2-5,11H,6-9H2,(H2,16,17,22)(H3,15,18,19,20);;/q-1;+2;-1 |
| InChIKey | DWRYPRBIJALEQF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|