C11H16N2 — CID 118170636
4-ethyl-2,3,4,9-tetrahydro-1H-pyrido[2,3-b]azepine (PubChem CID 118170636) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 4-ethyl-2,3,4,9-tetrahydro-1H-pyrido[2,3-b]azepine.
| Compound Name | 4-ethyl-2,3,4,9-tetrahydro-1H-pyrido[2,3-b]azepine |
|---|---|
| PubChem CID | 118170636 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 4-ethyl-2,3,4,9-tetrahydro-1H-pyrido[2,3-b]azepine |
| SMILES | CCC1CCNC2=C1C=CC=CN2 |
| InChI | InChI=1S/C11H16N2/c1-2-9-6-8-13-11-10(9)5-3-4-7-12-11/h3-5,7,9,12-13H,2,6,8H2,1H3 |
| InChIKey | HDWGNNPWGINZGC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |