C29H36F2O7 — CID 118175457
2-O-[1-[(2R,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]-1,1-difluoro-2-methylpropan-2-yl] 1-O-methyl oxalate (PubChem CID 118175457) has the molecular formula C29H36F2O7 and a molecular weight of 534.60 g/mol. Its IUPAC name is 2-O-[1-[(2R,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]-1,1-difluoro-2-methylpropan-2-yl] 1-O-methyl oxalate.
| Compound Name | 2-O-[1-[(2R,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]-1,1-difluoro-2-methylpropan-2-yl] 1-O-methyl oxalate |
|---|---|
| PubChem CID | 118175457 |
| Molecular Formula | C29H36F2O7 |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | 2-O-[1-[(2R,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]-1,1-difluoro-2-methylpropan-2-yl] 1-O-methyl oxalate |
| SMILES | CC[C@H]1O[C@@H](C(F)(F)C(C)(C)OC(=O)C(=O)OC)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C29H36F2O7/c1-6-22-19(2)23(35-17-20-13-9-7-10-14-20)24(36-18-21-15-11-8-12-16-21)25(37-22)29(30,31)28(3,4)38-27(33)26(32)34-5/h7-16,19,22-25H,6,17-18H2,1-5H3/t19-,22+,23-,24+,25+/m0/s1 |
| InChIKey | CMJMQVRVCSRLJO-WJYDCKGNSA-N |
| XLogP | 5.10 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|