C28H24F8O4S — CID 118220854
1-fluoro-3-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-5-methoxybenzene (PubChem CID 118220854) has the molecular formula C28H24F8O4S and a molecular weight of 608.55 g/mol. Its IUPAC name is 1-fluoro-3-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-5-methoxybenzene.
| Compound Name | 1-fluoro-3-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-5-methoxybenzene |
|---|---|
| PubChem CID | 118220854 |
| Molecular Formula | C28H24F8O4S |
| Molecular Weight | 608.55 g/mol |
| Exact Mass | 608.13 |
| IUPAC Name | 1-fluoro-3-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-5-methoxybenzene |
| SMILES | COc1cc(F)cc(COC(c2ccc(C3(S(=O)(=O)c4ccc(F)cc4)CCCC3)cc2)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C28H24F8O4S/c1-39-23-15-18(14-22(30)16-23)17-40-26(27(31,32)33,28(34,35)36)20-6-4-19(5-7-20)25(12-2-3-13-25)41(37,38)24-10-8-21(29)9-11-24/h4-11,14-16H,2-3,12-13,17H2,1H3 |
| InChIKey | ONGXTTQBEBGTSE-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.55 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |