C18H22F3N3O3 — CID 118234861
[1-cyclopropyl-5-(trifluoromethyl)pyrazol-4-yl] N-(5-hydroxy-2-adamantyl)carbamate (PubChem CID 118234861) has the molecular formula C18H22F3N3O3 and a molecular weight of 385.39 g/mol. Its IUPAC name is [1-cyclopropyl-5-(trifluoromethyl)pyrazol-4-yl] N-(5-hydroxy-2-adamantyl)carbamate.
| Compound Name | [1-cyclopropyl-5-(trifluoromethyl)pyrazol-4-yl] N-(5-hydroxy-2-adamantyl)carbamate |
|---|---|
| PubChem CID | 118234861 |
| Molecular Formula | C18H22F3N3O3 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | [1-cyclopropyl-5-(trifluoromethyl)pyrazol-4-yl] N-(5-hydroxy-2-adamantyl)carbamate |
| SMILES | O=C(NC1C2CC3CC1CC(O)(C3)C2)Oc1cnn(C2CC2)c1C(F)(F)F |
| InChI | InChI=1S/C18H22F3N3O3/c19-18(20,21)15-13(8-22-24(15)12-1-2-12)27-16(25)23-14-10-3-9-4-11(14)7-17(26,5-9)6-10/h8-12,14,26H,1-7H2,(H,23,25) |
| InChIKey | AJCZWVBHCLBLDM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |