C14H17F3N2O4 — CID 11823826
3-[hydroxy-[(E)-3-phenylprop-2-enoyl]amino]propylazanium;2,2,2-trifluoroacetate (PubChem CID 11823826) has the molecular formula C14H17F3N2O4 and a molecular weight of 334.29 g/mol. Its IUPAC name is 3-[hydroxy-[(E)-3-phenylprop-2-enoyl]amino]propylazanium;2,2,2-trifluoroacetate.
| Compound Name | 3-[hydroxy-[(E)-3-phenylprop-2-enoyl]amino]propylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 11823826 |
| Molecular Formula | C14H17F3N2O4 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 3-[hydroxy-[(E)-3-phenylprop-2-enoyl]amino]propylazanium;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.[NH3+]CCCN(O)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H16N2O2.C2HF3O2/c13-9-4-10-14(16)12(15)8-7-11-5-2-1-3-6-11;3-2(4,5)1(6)7/h1-3,5-8,16H,4,9-10,13H2;(H,6,7)/b8-7+; |
| InChIKey | HNCYOQLIUBPHJF-USRGLUTNSA-N |
| XLogP | -0.15 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|