C30H36N4O9 — CID 10952113
2-hydroxy-4-[3-[hydroxy-[(E)-3-phenylprop-2-enoyl]amino]propylamino]-2-[2-[3-[hydroxy-[(E)-3-phenylprop-2-enoyl]amino]propylamino]-2-oxoethyl]-4-oxobutanoic acid (PubChem CID 10952113) has the molecular formula C30H36N4O9 and a molecular weight of 596.64 g/mol. Its IUPAC name is 2-hydroxy-4-[3-[hydroxy-[(E)-3-phenylprop-2-enoyl]amino]propylamino]-2-[2-[3-[hydroxy-[(E)-3-phenylprop-2-enoyl]amino]propylamino]-2-oxoethyl]-4-oxobutanoic acid.
| Compound Name | 2-hydroxy-4-[3-[hydroxy-[(E)-3-phenylprop-2-enoyl]amino]propylamino]-2-[2-[3-[hydroxy-[(E)-3-phenylprop-2-enoyl]amino]propylamino]-2-oxoethyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 10952113 |
| Molecular Formula | C30H36N4O9 |
| Molecular Weight | 596.64 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | 2-hydroxy-4-[3-[hydroxy-[(E)-3-phenylprop-2-enoyl]amino]propylamino]-2-[2-[3-[hydroxy-[(E)-3-phenylprop-2-enoyl]amino]propylamino]-2-oxoethyl]-4-oxobutanoic acid |
| SMILES | O=C(CC(O)(CC(=O)NCCCN(O)C(=O)/C=C/c1ccccc1)C(=O)O)NCCCN(O)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C30H36N4O9/c35-25(31-17-7-19-33(42)27(37)15-13-23-9-3-1-4-10-23)21-30(41,29(39)40)22-26(36)32-18-8-20-34(43)28(38)16-14-24-11-5-2-6-12-24/h1-6,9-16,41-43H,7-8,17-22H2,(H,31,35)(H,32,36)(H,39,40)/b15-13+,16-14+ |
| InChIKey | WBCMWVHMHSBDKL-WXUKJITCSA-N |
| XLogP | 1.46 |
| TPSA | 196.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.64 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|