C16H14BrF3N2O9 — CID 118240379
1,1-dinitrooxypropan-2-yl 6-bromo-5,7-bis(trideuteriomethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 118240379) has the molecular formula C16H14BrF3N2O9 and a molecular weight of 521.23 g/mol. Its IUPAC name is 1,1-dinitrooxypropan-2-yl 6-bromo-5,7-bis(trideuteriomethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 1,1-dinitrooxypropan-2-yl 6-bromo-5,7-bis(trideuteriomethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 118240379 |
| Molecular Formula | C16H14BrF3N2O9 |
| Molecular Weight | 521.23 g/mol |
| Exact Mass | 520.02 |
| IUPAC Name | 1,1-dinitrooxypropan-2-yl 6-bromo-5,7-bis(trideuteriomethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | [2H]C([2H])([2H])c1cc2c(c(C([2H])([2H])[2H])c1Br)C=C(C(=O)OC(C)C(O[N+](=O)[O-])O[N+](=O)[O-])C(C(F)(F)F)O2 |
| InChI | InChI=1S/C16H14BrF3N2O9/c1-6-4-11-9(7(2)12(6)17)5-10(13(29-11)16(18,19)20)14(23)28-8(3)15(30-21(24)25)31-22(26)27/h4-5,8,13,15H,1-3H3/i1D3,2D3 |
| InChIKey | LDDWZQNNOYBMBD-WFGJKAKNSA-N |
| XLogP | 3.45 |
| TPSA | 140.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.23 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|