C15H15ClF3NO10 — CID 144889964
1-aminooxyethyl 6-chloro-2-(trifluoromethyl)-5,7-bis(trihydroxymethyl)-2H-chromene-3-carboxylate (PubChem CID 144889964) has the molecular formula C15H15ClF3NO10 and a molecular weight of 461.73 g/mol. Its IUPAC name is 1-aminooxyethyl 6-chloro-2-(trifluoromethyl)-5,7-bis(trihydroxymethyl)-2H-chromene-3-carboxylate.
| Compound Name | 1-aminooxyethyl 6-chloro-2-(trifluoromethyl)-5,7-bis(trihydroxymethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 144889964 |
| Molecular Formula | C15H15ClF3NO10 |
| Molecular Weight | 461.73 g/mol |
| Exact Mass | 461.03 |
| IUPAC Name | 1-aminooxyethyl 6-chloro-2-(trifluoromethyl)-5,7-bis(trihydroxymethyl)-2H-chromene-3-carboxylate |
| SMILES | CC(ON)OC(=O)C1=Cc2c(cc(C(O)(O)O)c(Cl)c2C(O)(O)O)OC1C(F)(F)F |
| InChI | InChI=1S/C15H15ClF3NO10/c1-4(30-20)28-12(21)6-2-5-8(29-11(6)13(17,18)19)3-7(14(22,23)24)10(16)9(5)15(25,26)27/h2-4,11,22-27H,20H2,1H3 |
| InChIKey | HIUKIHARXCVULT-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 192.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.73 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|