C17H18O6Se — CID 11825449
dimethyl 2-[(1S,3R,4S,7R)-5-oxo-3-phenylselanyl-2-oxabicyclo[2.2.1]heptan-7-yl]propanedioate (PubChem CID 11825449) has the molecular formula C17H18O6Se and a molecular weight of 397.29 g/mol. Its IUPAC name is dimethyl 2-[(1S,3R,4S,7R)-5-oxo-3-phenylselanyl-2-oxabicyclo[2.2.1]heptan-7-yl]propanedioate.
| Compound Name | dimethyl 2-[(1S,3R,4S,7R)-5-oxo-3-phenylselanyl-2-oxabicyclo[2.2.1]heptan-7-yl]propanedioate |
|---|---|
| PubChem CID | 11825449 |
| Molecular Formula | C17H18O6Se |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | dimethyl 2-[(1S,3R,4S,7R)-5-oxo-3-phenylselanyl-2-oxabicyclo[2.2.1]heptan-7-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H]1[C@H]2C(=O)C[C@@H]1O[C@@H]2[Se]c1ccccc1 |
| InChI | InChI=1S/C17H18O6Se/c1-21-15(19)14(16(20)22-2)13-11-8-10(18)12(13)17(23-11)24-9-6-4-3-5-7-9/h3-7,11-14,17H,8H2,1-2H3/t11-,12+,13-,17+/m0/s1 |
| InChIKey | DVISPZLVBYPCAJ-PFHKOEEOSA-N |
| XLogP | -0.09 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|