C16H18O4Se — CID 139265050
methyl (3aR,7aR)-2-oxo-3-phenylselanyl-3a,4,5,6,7,7a-hexahydro-1-benzofuran-3-carboxylate (PubChem CID 139265050) has the molecular formula C16H18O4Se and a molecular weight of 353.28 g/mol. Its IUPAC name is methyl (3aR,7aR)-2-oxo-3-phenylselanyl-3a,4,5,6,7,7a-hexahydro-1-benzofuran-3-carboxylate.
| Compound Name | methyl (3aR,7aR)-2-oxo-3-phenylselanyl-3a,4,5,6,7,7a-hexahydro-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 139265050 |
| Molecular Formula | C16H18O4Se |
| Molecular Weight | 353.28 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | methyl (3aR,7aR)-2-oxo-3-phenylselanyl-3a,4,5,6,7,7a-hexahydro-1-benzofuran-3-carboxylate |
| SMILES | COC(=O)C1([Se]c2ccccc2)C(=O)O[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C16H18O4Se/c1-19-14(17)16(21-11-7-3-2-4-8-11)12-9-5-6-10-13(12)20-15(16)18/h2-4,7-8,12-13H,5-6,9-10H2,1H3/t12-,13-,16?/m1/s1 |
| InChIKey | LZZIDOUAJBDWDS-SXMVJOELSA-N |
| XLogP | 1.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|