C21H32O4SeSi — CID 10895713
methyl 2-[(1S,4S,5R,7R)-5-[tert-butyl(dimethyl)silyl]oxy-3-phenylselanyl-2-oxabicyclo[2.2.1]heptan-7-yl]acetate (PubChem CID 10895713) has the molecular formula C21H32O4SeSi and a molecular weight of 455.53 g/mol. Its IUPAC name is methyl 2-[(1S,4S,5R,7R)-5-[tert-butyl(dimethyl)silyl]oxy-3-phenylselanyl-2-oxabicyclo[2.2.1]heptan-7-yl]acetate.
| Compound Name | methyl 2-[(1S,4S,5R,7R)-5-[tert-butyl(dimethyl)silyl]oxy-3-phenylselanyl-2-oxabicyclo[2.2.1]heptan-7-yl]acetate |
|---|---|
| PubChem CID | 10895713 |
| Molecular Formula | C21H32O4SeSi |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | methyl 2-[(1S,4S,5R,7R)-5-[tert-butyl(dimethyl)silyl]oxy-3-phenylselanyl-2-oxabicyclo[2.2.1]heptan-7-yl]acetate |
| SMILES | COC(=O)C[C@@H]1[C@@H]2C([Se]c3ccccc3)O[C@H]1C[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H32O4SeSi/c1-21(2,3)27(5,6)25-17-13-16-15(12-18(22)23-4)19(17)20(24-16)26-14-10-8-7-9-11-14/h7-11,15-17,19-20H,12-13H2,1-6H3/t15-,16-,17+,19-,20?/m0/s1 |
| InChIKey | XZEVYVXUMDVWET-BLAHECNWSA-N |
| XLogP | 3.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|