C25H30O3Si — CID 134849711
(3aR,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-4-ethenyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 134849711) has the molecular formula C25H30O3Si and a molecular weight of 406.60 g/mol. Its IUPAC name is (3aR,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-4-ethenyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-4-ethenyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 134849711 |
| Molecular Formula | C25H30O3Si |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (3aR,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-4-ethenyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | C=CC1C(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H]2OC(=O)C[C@H]12 |
| InChI | InChI=1S/C25H30O3Si/c1-5-20-21-16-24(26)27-22(21)17-23(20)28-29(25(2,3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h5-15,20-23H,1,16-17H2,2-4H3/t20?,21-,22+,23?/m1/s1 |
| InChIKey | TWSGRFQCGHFJHM-JSPDHQCPSA-N |
| XLogP | 4.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|