C17H21F5O9S — CID 118265160
1,1-difluoro-2-oxo-2-[4',7',7'-trimethyl-4-[(2,2,2-trifluoroacetyl)oxymethyl]spiro[1,3-dioxolane-2,3'-bicyclo[2.2.1]heptane]-2'-yl]oxyethanesulfonic acid (PubChem CID 118265160) has the molecular formula C17H21F5O9S and a molecular weight of 496.40 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[4',7',7'-trimethyl-4-[(2,2,2-trifluoroacetyl)oxymethyl]spiro[1,3-dioxolane-2,3'-bicyclo[2.2.1]heptane]-2'-yl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[4',7',7'-trimethyl-4-[(2,2,2-trifluoroacetyl)oxymethyl]spiro[1,3-dioxolane-2,3'-bicyclo[2.2.1]heptane]-2'-yl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 118265160 |
| Molecular Formula | C17H21F5O9S |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[4',7',7'-trimethyl-4-[(2,2,2-trifluoroacetyl)oxymethyl]spiro[1,3-dioxolane-2,3'-bicyclo[2.2.1]heptane]-2'-yl]oxyethanesulfonic acid |
| SMILES | CC1(C)C2CCC1(C)C1(OCC(COC(=O)C(F)(F)F)O1)C2OC(=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C17H21F5O9S/c1-13(2)9-4-5-14(13,3)15(10(9)30-12(24)17(21,22)32(25,26)27)29-7-8(31-15)6-28-11(23)16(18,19)20/h8-10H,4-7H2,1-3H3,(H,25,26,27) |
| InChIKey | LHBRHLVIVDYSKE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|