C14H20F2O5S3 — CID 88989660
1,1-difluoro-2-oxo-2-(4',7',7'-trimethylspiro[1,3-dithiolane-2,3'-bicyclo[2.2.1]heptane]-2'-yl)oxyethanesulfonic acid (PubChem CID 88989660) has the molecular formula C14H20F2O5S3 and a molecular weight of 402.51 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-(4',7',7'-trimethylspiro[1,3-dithiolane-2,3'-bicyclo[2.2.1]heptane]-2'-yl)oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-(4',7',7'-trimethylspiro[1,3-dithiolane-2,3'-bicyclo[2.2.1]heptane]-2'-yl)oxyethanesulfonic acid |
|---|---|
| PubChem CID | 88989660 |
| Molecular Formula | C14H20F2O5S3 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-(4',7',7'-trimethylspiro[1,3-dithiolane-2,3'-bicyclo[2.2.1]heptane]-2'-yl)oxyethanesulfonic acid |
| SMILES | CC1(C)C2CCC1(C)C1(SCCS1)C2OC(=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C14H20F2O5S3/c1-11(2)8-4-5-12(11,3)13(22-6-7-23-13)9(8)21-10(17)14(15,16)24(18,19)20/h8-9H,4-7H2,1-3H3,(H,18,19,20) |
| InChIKey | VQKQELIDGARCIQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|