C18H18F8O11S — CID 126756014
2-[(4'R)-5,5-bis[(2,2,2-trifluoroacetyl)oxymethyl]spiro[1,3-dioxane-2,3'-bicyclo[2.2.1]heptane]-2'-yl]oxy-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 126756014) has the molecular formula C18H18F8O11S and a molecular weight of 594.38 g/mol. Its IUPAC name is 2-[(4'R)-5,5-bis[(2,2,2-trifluoroacetyl)oxymethyl]spiro[1,3-dioxane-2,3'-bicyclo[2.2.1]heptane]-2'-yl]oxy-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[(4'R)-5,5-bis[(2,2,2-trifluoroacetyl)oxymethyl]spiro[1,3-dioxane-2,3'-bicyclo[2.2.1]heptane]-2'-yl]oxy-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 126756014 |
| Molecular Formula | C18H18F8O11S |
| Molecular Weight | 594.38 g/mol |
| Exact Mass | 594.04 |
| IUPAC Name | 2-[(4'R)-5,5-bis[(2,2,2-trifluoroacetyl)oxymethyl]spiro[1,3-dioxane-2,3'-bicyclo[2.2.1]heptane]-2'-yl]oxy-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | O=C(OCC1(COC(=O)C(F)(F)F)COC2(OC1)C(OC(=O)C(F)(F)S(=O)(=O)O)C1CC[C@@H]2C1)C(F)(F)F |
| InChI | InChI=1S/C18H18F8O11S/c19-16(20,21)11(27)33-4-14(5-34-12(28)17(22,23)24)6-35-15(36-7-14)9-2-1-8(3-9)10(15)37-13(29)18(25,26)38(30,31)32/h8-10H,1-7H2,(H,30,31,32)/t8?,9-,10?/m1/s1 |
| InChIKey | IVIBUQBBCXLNDZ-HWOCKDDLSA-N |
| XLogP | 1.75 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|