C19H24F8O11S — CID 126756021
1,1-difluoro-2-oxo-2-[[3-[(3,3,3-trifluoro-1-hydroxypropoxy)methyl]-3-(3,3,3-trifluoropropanoyloxymethyl)-1,5-dioxaspiro[5.5]undecan-11-yl]oxy]ethanesulfonic acid (PubChem CID 126756021) has the molecular formula C19H24F8O11S and a molecular weight of 612.44 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[[3-[(3,3,3-trifluoro-1-hydroxypropoxy)methyl]-3-(3,3,3-trifluoropropanoyloxymethyl)-1,5-dioxaspiro[5.5]undecan-11-yl]oxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[[3-[(3,3,3-trifluoro-1-hydroxypropoxy)methyl]-3-(3,3,3-trifluoropropanoyloxymethyl)-1,5-dioxaspiro[5.5]undecan-11-yl]oxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 126756021 |
| Molecular Formula | C19H24F8O11S |
| Molecular Weight | 612.44 g/mol |
| Exact Mass | 612.09 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[[3-[(3,3,3-trifluoro-1-hydroxypropoxy)methyl]-3-(3,3,3-trifluoropropanoyloxymethyl)-1,5-dioxaspiro[5.5]undecan-11-yl]oxy]ethanesulfonic acid |
| SMILES | O=C(CC(F)(F)F)OCC1(COC(O)CC(F)(F)F)COC2(CCCCC2OC(=O)C(F)(F)S(=O)(=O)O)OC1 |
| InChI | InChI=1S/C19H24F8O11S/c20-17(21,22)5-12(28)34-7-15(8-35-13(29)6-18(23,24)25)9-36-16(37-10-15)4-2-1-3-11(16)38-14(30)19(26,27)39(31,32)33/h11-12,28H,1-10H2,(H,31,32,33) |
| InChIKey | BNPLJGVFPNJCBB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 154.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|