C10H11F3INO — CID 118271932
N-iodo-N-(3,3,3-trifluoropropyl)cyclohexa-1,3-diene-1-carboxamide (PubChem CID 118271932) has the molecular formula C10H11F3INO and a molecular weight of 345.10 g/mol. Its IUPAC name is N-iodo-N-(3,3,3-trifluoropropyl)cyclohexa-1,3-diene-1-carboxamide.
| Compound Name | N-iodo-N-(3,3,3-trifluoropropyl)cyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 118271932 |
| Molecular Formula | C10H11F3INO |
| Molecular Weight | 345.10 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | N-iodo-N-(3,3,3-trifluoropropyl)cyclohexa-1,3-diene-1-carboxamide |
| SMILES | O=C(C1=CC=CCC1)N(I)CCC(F)(F)F |
| InChI | InChI=1S/C10H11F3INO/c11-10(12,13)6-7-15(14)9(16)8-4-2-1-3-5-8/h1-2,4H,3,5-7H2 |
| InChIKey | BMZOOWGYEDNWCX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.10 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|