C16H23F2NO — CID 170274373
(2E,4Z)-1-(4,4-difluoropiperidin-1-yl)-2-[(E)-pent-2-en-2-yl]hexa-2,4-dien-1-one (PubChem CID 170274373) has the molecular formula C16H23F2NO and a molecular weight of 283.36 g/mol. Its IUPAC name is (2E,4Z)-1-(4,4-difluoropiperidin-1-yl)-2-[(E)-pent-2-en-2-yl]hexa-2,4-dien-1-one.
| Compound Name | (2E,4Z)-1-(4,4-difluoropiperidin-1-yl)-2-[(E)-pent-2-en-2-yl]hexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 170274373 |
| Molecular Formula | C16H23F2NO |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | (2E,4Z)-1-(4,4-difluoropiperidin-1-yl)-2-[(E)-pent-2-en-2-yl]hexa-2,4-dien-1-one |
| SMILES | C/C=C\C=C(C(=O)N1CCC(F)(F)CC1)/C(C)=C/CC |
| InChI | InChI=1S/C16H23F2NO/c1-4-6-8-14(13(3)7-5-2)15(20)19-11-9-16(17,18)10-12-19/h4,6-8H,5,9-12H2,1-3H3/b6-4-,13-7+,14-8+ |
| InChIKey | HLWFLONWBAYBNC-ULQNLPGHSA-N |
| XLogP | 4.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|