C40H50N8O5 — CID 11828680
3-(butanoylamino)-4-(dibutylamino)-N-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(naphthalen-1-ylmethylamino)purin-9-yl]oxolan-2-yl]methyl]benzamide (PubChem CID 11828680) has the molecular formula C40H50N8O5 and a molecular weight of 722.89 g/mol. Its IUPAC name is 3-(butanoylamino)-4-(dibutylamino)-N-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(naphthalen-1-ylmethylamino)purin-9-yl]oxolan-2-yl]methyl]benzamide.
| Compound Name | 3-(butanoylamino)-4-(dibutylamino)-N-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(naphthalen-1-ylmethylamino)purin-9-yl]oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 11828680 |
| Molecular Formula | C40H50N8O5 |
| Molecular Weight | 722.89 g/mol |
| Exact Mass | 722.39 |
| IUPAC Name | 3-(butanoylamino)-4-(dibutylamino)-N-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(naphthalen-1-ylmethylamino)purin-9-yl]oxolan-2-yl]methyl]benzamide |
| SMILES | CCCCN(CCCC)c1ccc(C(=O)NC[C@H]2O[C@@H](n3cnc4c(NCc5cccc6ccccc56)ncnc43)[C@H](O)[C@@H]2O)cc1NC(=O)CCC |
| InChI | InChI=1S/C40H50N8O5/c1-4-7-19-47(20-8-5-2)31-18-17-27(21-30(31)46-33(49)12-6-3)39(52)42-23-32-35(50)36(51)40(53-32)48-25-45-34-37(43-24-44-38(34)48)41-22-28-15-11-14-26-13-9-10-16-29(26)28/h9-11,13-18,21,24-25,32,35-36,40,50-51H,4-8,12,19-20,22-23H2,1-3H3,(H,42,52)(H,46,49)(H,41,43,44)/t32-,35-,36-,40-/m1/s1 |
| InChIKey | BCKRJZYASFMTJP-CKODAUBMSA-N |
| XLogP | 5.79 |
| TPSA | 166.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.89 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |