C32H23NO4 — CID 118288370
dinaphthalen-1-ylmethyl (2S)-2-(2,3-dioxoindol-1-yl)propanoate (PubChem CID 118288370) has the molecular formula C32H23NO4 and a molecular weight of 485.54 g/mol. Its IUPAC name is dinaphthalen-1-ylmethyl (2S)-2-(2,3-dioxoindol-1-yl)propanoate.
| Compound Name | dinaphthalen-1-ylmethyl (2S)-2-(2,3-dioxoindol-1-yl)propanoate |
|---|---|
| PubChem CID | 118288370 |
| Molecular Formula | C32H23NO4 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | dinaphthalen-1-ylmethyl (2S)-2-(2,3-dioxoindol-1-yl)propanoate |
| SMILES | C[C@@H](C(=O)OC(c1cccc2ccccc12)c1cccc2ccccc12)N1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C32H23NO4/c1-20(33-28-19-7-6-16-27(28)29(34)31(33)35)32(36)37-30(25-17-8-12-21-10-2-4-14-23(21)25)26-18-9-13-22-11-3-5-15-24(22)26/h2-20,30H,1H3/t20-/m0/s1 |
| InChIKey | LMDUVQCAXQHUII-FQEVSTJZSA-N |
| XLogP | 6.24 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|