C10H11BrF2O2 — CID 118308963
methyl 2-(2-bromoethynyl)-4,4-difluorocyclohexane-1-carboxylate (PubChem CID 118308963) has the molecular formula C10H11BrF2O2 and a molecular weight of 281.10 g/mol. Its IUPAC name is methyl 2-(2-bromoethynyl)-4,4-difluorocyclohexane-1-carboxylate.
| Compound Name | methyl 2-(2-bromoethynyl)-4,4-difluorocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118308963 |
| Molecular Formula | C10H11BrF2O2 |
| Molecular Weight | 281.10 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | methyl 2-(2-bromoethynyl)-4,4-difluorocyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(F)(F)CC1C#CBr |
| InChI | InChI=1S/C10H11BrF2O2/c1-15-9(14)8-2-4-10(12,13)6-7(8)3-5-11/h7-8H,2,4,6H2,1H3 |
| InChIKey | ZPMHLUVUBLVZMX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.10 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|