About trans-methyl (1S,2S)-2-amino-3,3-difluorocyclopentane-1-carboxylate
trans-methyl (1S,2S)-2-amino-3,3-difluorocyclopentane-1-carboxylate (PubChem CID 42640503) has the molecular formula C7H11F2NO2
and a molecular weight of 179.17 g/mol. Its IUPAC name is trans-methyl (1S,2S)-2-amino-3,3-difluorocyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | trans-methyl (1S,2S)-2-amino-3,3-difluorocyclopentane-1-carboxylate |
| PubChem CID | 42640503 |
| Molecular Formula | C7H11F2NO2 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | trans-methyl (1S,2S)-2-amino-3,3-difluorocyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@H]1CCC(F)(F)[C@H]1N |
| InChI | InChI=1S/C7H11F2NO2/c1-12-6(11)4-2-3-7(8,9)5(4)10/h4-5H,2-3,10H2,1H3/t4-,5-/m0/s1 |
| InChIKey | JNQCXERDANLFKN-WHFBIAKZSA-N |
| XLogP | 0.53 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trans-methyl (1S,2S)-2-amino-3,3-difluorocyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-methyl (1S,2S)-2-amino-3,3-difluorocyclopentane-1-carboxylate?
The IUPAC name of trans-methyl (1S,2S)-2-amino-3,3-difluorocyclopentane-1-carboxylate (CID 42640503) is trans-methyl (1S,2S)-2-amino-3,3-difluorocyclopentane-1-carboxylate.
What is the SMILES notation for trans-methyl (1S,2S)-2-amino-3,3-difluorocyclopentane-1-carboxylate?
The canonical SMILES for trans-methyl (1S,2S)-2-amino-3,3-difluorocyclopentane-1-carboxylate is COC(=O)[C@H]1CCC(F)(F)[C@H]1N.
What is the InChIKey of trans-methyl (1S,2S)-2-amino-3,3-difluorocyclopentane-1-carboxylate?
The InChIKey is JNQCXERDANLFKN-WHFBIAKZSA-N. The full InChI is InChI=1S/C7H11F2NO2/c1-12-6(11)4-2-3-7(8,9)5(4)10/h4-5H,2-3,10H2,1H3/t4-,5-/m0/s1.
What are the key properties of trans-methyl (1S,2S)-2-amino-3,3-difluorocyclopentane-1-carboxylate?
trans-methyl (1S,2S)-2-amino-3,3-difluorocyclopentane-1-carboxylate has a molecular weight of 179.17 g/mol, XLogP of 0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-methyl (1S,2S)-2-amino-3,3-difluorocyclopentane-1-carboxylate is sourced from PubChem (CID 42640503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).