C26H52N2O3S — CID 118336640
nonadecan-10-yl N-[3-(dimethylamino)propylsulfanylcarbonyl]carbamate (PubChem CID 118336640) has the molecular formula C26H52N2O3S and a molecular weight of 472.78 g/mol. Its IUPAC name is nonadecan-10-yl N-[3-(dimethylamino)propylsulfanylcarbonyl]carbamate.
| Compound Name | nonadecan-10-yl N-[3-(dimethylamino)propylsulfanylcarbonyl]carbamate |
|---|---|
| PubChem CID | 118336640 |
| Molecular Formula | C26H52N2O3S |
| Molecular Weight | 472.78 g/mol |
| Exact Mass | 472.37 |
| IUPAC Name | nonadecan-10-yl N-[3-(dimethylamino)propylsulfanylcarbonyl]carbamate |
| SMILES | CCCCCCCCCC(CCCCCCCCC)OC(=O)NC(=O)SCCCN(C)C |
| InChI | InChI=1S/C26H52N2O3S/c1-5-7-9-11-13-15-17-20-24(21-18-16-14-12-10-8-6-2)31-25(29)27-26(30)32-23-19-22-28(3)4/h24H,5-23H2,1-4H3,(H,27,29,30) |
| InChIKey | HZMNORFUBFZFPQ-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.78 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|