C25H20F2N2O3 — CID 118341561
3-[[2,6-difluoro-4-(2-phenylethynyl)phenyl]carbamoylamino]-3-phenylbutanoic acid (PubChem CID 118341561) has the molecular formula C25H20F2N2O3 and a molecular weight of 434.44 g/mol. Its IUPAC name is 3-[[2,6-difluoro-4-(2-phenylethynyl)phenyl]carbamoylamino]-3-phenylbutanoic acid.
| Compound Name | 3-[[2,6-difluoro-4-(2-phenylethynyl)phenyl]carbamoylamino]-3-phenylbutanoic acid |
|---|---|
| PubChem CID | 118341561 |
| Molecular Formula | C25H20F2N2O3 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 3-[[2,6-difluoro-4-(2-phenylethynyl)phenyl]carbamoylamino]-3-phenylbutanoic acid |
| SMILES | CC(CC(=O)O)(NC(=O)Nc1c(F)cc(C#Cc2ccccc2)cc1F)c1ccccc1 |
| InChI | InChI=1S/C25H20F2N2O3/c1-25(16-22(30)31,19-10-6-3-7-11-19)29-24(32)28-23-20(26)14-18(15-21(23)27)13-12-17-8-4-2-5-9-17/h2-11,14-15H,16H2,1H3,(H,30,31)(H2,28,29,32) |
| InChIKey | UOPHIJAQPLLMKM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|