C18H19F7N2O3 — CID 118347426
tert-butyl N-[(E,2S)-1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]hex-4-en-2-yl]carbamate (PubChem CID 118347426) has the molecular formula C18H19F7N2O3 and a molecular weight of 444.35 g/mol. Its IUPAC name is tert-butyl N-[(E,2S)-1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]hex-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E,2S)-1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]hex-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 118347426 |
| Molecular Formula | C18H19F7N2O3 |
| Molecular Weight | 444.35 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | tert-butyl N-[(E,2S)-1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]hex-4-en-2-yl]carbamate |
| SMILES | C/C=C/C[C@H](NC(=O)OC(C)(C)C)C(=O)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C18H19F7N2O3/c1-5-6-7-8(26-16(29)30-17(2,3)4)15(28)27-14-12(21)10(19)9(18(23,24)25)11(20)13(14)22/h5-6,8H,7H2,1-4H3,(H,26,29)(H,27,28)/b6-5+/t8-/m0/s1 |
| InChIKey | RMJIPQJUGYBEBW-GJIOHYHPSA-N |
| XLogP | 5.06 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.35 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|