C15H21F4N3O2 — CID 133388059
tert-butyl N-[3-methyl-1-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]butan-2-yl]carbamate (PubChem CID 133388059) has the molecular formula C15H21F4N3O2 and a molecular weight of 351.34 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-1-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-1-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 133388059 |
| Molecular Formula | C15H21F4N3O2 |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | tert-butyl N-[3-methyl-1-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]butan-2-yl]carbamate |
| SMILES | CC(C)C(CNc1c(F)c(F)nc(F)c1F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H21F4N3O2/c1-7(2)8(21-14(23)24-15(3,4)5)6-20-11-9(16)12(18)22-13(19)10(11)17/h7-8H,6H2,1-5H3,(H,20,22)(H,21,23) |
| InChIKey | PPMCKKYDDKKMLC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|