C10H23NO4S — CID 118351314
4-[2-hydroxyethyl(methyl)amino]-2,4-dimethylpentane-2-sulfonic acid (PubChem CID 118351314) has the molecular formula C10H23NO4S and a molecular weight of 253.36 g/mol. Its IUPAC name is 4-[2-hydroxyethyl(methyl)amino]-2,4-dimethylpentane-2-sulfonic acid.
| Compound Name | 4-[2-hydroxyethyl(methyl)amino]-2,4-dimethylpentane-2-sulfonic acid |
|---|---|
| PubChem CID | 118351314 |
| Molecular Formula | C10H23NO4S |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 4-[2-hydroxyethyl(methyl)amino]-2,4-dimethylpentane-2-sulfonic acid |
| SMILES | CN(CCO)C(C)(C)CC(C)(C)S(=O)(=O)O |
| InChI | InChI=1S/C10H23NO4S/c1-9(2,11(5)6-7-12)8-10(3,4)16(13,14)15/h12H,6-8H2,1-5H3,(H,13,14,15) |
| InChIKey | CMTSPVSHTXHHPJ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|