C9H14N2 — CID 118358873
3,5-bis[(E)-prop-1-enyl]-4,5-dihydro-1H-pyrazole (PubChem CID 118358873) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 3,5-bis[(E)-prop-1-enyl]-4,5-dihydro-1H-pyrazole.
| Compound Name | 3,5-bis[(E)-prop-1-enyl]-4,5-dihydro-1H-pyrazole |
|---|---|
| PubChem CID | 118358873 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 3,5-bis[(E)-prop-1-enyl]-4,5-dihydro-1H-pyrazole |
| SMILES | C/C=C/C1=NNC(/C=C/C)C1 |
| InChI | InChI=1S/C9H14N2/c1-3-5-8-7-9(6-4-2)11-10-8/h3-6,8,10H,7H2,1-2H3/b5-3+,6-4+ |
| InChIKey | JVOXLFLSGVUUOE-GGWOSOGESA-N |
| XLogP | 1.86 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|